C26H38N2O4 — CID 91570246
2-(2,4-dimethylphenoxy)-N-methylbutanamide;4-(2,4-dimethylphenoxy)-N-methylbutanamide (PubChem CID 91570246) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-methylbutanamide;4-(2,4-dimethylphenoxy)-N-methylbutanamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-methylbutanamide;4-(2,4-dimethylphenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 91570246 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-methylbutanamide;4-(2,4-dimethylphenoxy)-N-methylbutanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)NC.CNC(=O)CCCOc1ccc(C)cc1C |
| InChI | InChI=1S/2C13H19NO2/c1-10-6-7-12(11(2)9-10)16-8-4-5-13(15)14-3;1-5-11(13(15)14-4)16-12-7-6-9(2)8-10(12)3/h6-7,9H,4-5,8H2,1-3H3,(H,14,15);6-8,11H,5H2,1-4H3,(H,14,15) |
| InChIKey | NXWQLIKOQQAQEI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|