C19H27NO3 — CID 91570988
(3aS,11aR)-10-methyl-3-methylidene-6-(morpholin-4-ylmethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 91570988) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3aS,11aR)-10-methyl-3-methylidene-6-(morpholin-4-ylmethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,11aR)-10-methyl-3-methylidene-6-(morpholin-4-ylmethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 91570988 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3aS,11aR)-10-methyl-3-methylidene-6-(morpholin-4-ylmethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2C=C(C)CCC=C(CN3CCOCC3)CC[C@@H]12 |
| InChI | InChI=1S/C19H27NO3/c1-14-4-3-5-16(13-20-8-10-22-11-9-20)6-7-17-15(2)19(21)23-18(17)12-14/h5,12,17-18H,2-4,6-11,13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | LEKJEUJVOZNDNE-ZWKOTPCHSA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|