C11H15NOS — CID 91571440
2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-one (PubChem CID 91571440) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-one.
| Compound Name | 2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-one |
|---|---|
| PubChem CID | 91571440 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-5-en-1-one |
| SMILES | C=CCCC(C)C(=O)c1csc(C)n1 |
| InChI | InChI=1S/C11H15NOS/c1-4-5-6-8(2)11(13)10-7-14-9(3)12-10/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | KRPUHBOUYGQBIS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|