C16H24F3NOS — CID 150419911
2-propyl-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]nonan-1-one (PubChem CID 150419911) has the molecular formula C16H24F3NOS and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-propyl-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]nonan-1-one.
| Compound Name | 2-propyl-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]nonan-1-one |
|---|---|
| PubChem CID | 150419911 |
| Molecular Formula | C16H24F3NOS |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-propyl-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]nonan-1-one |
| SMILES | CCCCCCCC(CCC)C(=O)c1csc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H24F3NOS/c1-3-5-6-7-8-10-12(9-4-2)14(21)13-11-22-15(20-13)16(17,18)19/h11-12H,3-10H2,1-2H3 |
| InChIKey | HHNZOYFJARUUNW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|