C18H28F3NOS — CID 138627846
2-hexyl-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]octan-1-one (PubChem CID 138627846) has the molecular formula C18H28F3NOS and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-hexyl-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]octan-1-one.
| Compound Name | 2-hexyl-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]octan-1-one |
|---|---|
| PubChem CID | 138627846 |
| Molecular Formula | C18H28F3NOS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-hexyl-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]octan-1-one |
| SMILES | CCCCCCC(CCCCCC)C(=O)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H28F3NOS/c1-3-5-7-9-11-14(12-10-8-6-4-2)16(23)17-22-15(13-24-17)18(19,20)21/h13-14H,3-12H2,1-2H3 |
| InChIKey | YHCQFIQEJDKZCL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|