C14H26O6 — CID 91572716
1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-methoxyoxolan-2-yl]-2-hydroxynonan-1-one (PubChem CID 91572716) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-methoxyoxolan-2-yl]-2-hydroxynonan-1-one.
| Compound Name | 1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-methoxyoxolan-2-yl]-2-hydroxynonan-1-one |
|---|---|
| PubChem CID | 91572716 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-methoxyoxolan-2-yl]-2-hydroxynonan-1-one |
| SMILES | CCCCCCCC(O)C(=O)[C@H]1O[C@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H26O6/c1-3-4-5-6-7-8-9(15)10(16)13-11(17)12(18)14(19-2)20-13/h9,11-15,17-18H,3-8H2,1-2H3/t9?,11-,12-,13+,14-/m0/s1 |
| InChIKey | JFTUDFNJYMTTFH-IMBIGWSGSA-N |
| XLogP | 0.37 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|