About 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine
1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine (PubChem CID 91574357) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine.
Molecular Properties
| Compound Name | 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine |
| PubChem CID | 91574357 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine |
| SMILES | C=C=C1C=CC(C)(C)C=NN1C(C)(C)C |
| InChI | InChI=1S/C13H20N2/c1-7-11-8-9-13(5,6)10-14-15(11)12(2,3)4/h8-10H,1H2,2-6H3 |
| InChIKey | LANFYLARDITXIE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine?
The IUPAC name of 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine (CID 91574357) is 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine.
What is the SMILES notation for 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine?
The canonical SMILES for 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine is C=C=C1C=CC(C)(C)C=NN1C(C)(C)C.
What is the InChIKey of 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine?
The InChIKey is LANFYLARDITXIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-7-11-8-9-13(5,6)10-14-15(11)12(2,3)4/h8-10H,1H2,2-6H3.
What are the key properties of 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine?
1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine has a molecular weight of 204.32 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-7-ethenylidene-4,4-dimethyldiazepine is sourced from PubChem (CID 91574357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).