About ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane
ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane (PubChem CID 91575289) has the molecular formula C18H40O5S
and a molecular weight of 368.58 g/mol. Its IUPAC name is ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane.
Molecular Properties
| Compound Name | ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane |
| PubChem CID | 91575289 |
| Molecular Formula | C18H40O5S |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane |
| SMILES | CCC(C)C.CCOS(=O)(=O)CCCOCCCCOC(C)CC |
| InChI | InChI=1S/C13H28O5S.C5H12/c1-4-13(3)17-11-7-6-9-16-10-8-12-19(14,15)18-5-2;1-4-5(2)3/h13H,4-12H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | PHVWIZNCYWRMIR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane?
The IUPAC name of ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane (CID 91575289) is ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane.
What is the SMILES notation for ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane?
The canonical SMILES for ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane is CCC(C)C.CCOS(=O)(=O)CCCOCCCCOC(C)CC.
What is the InChIKey of ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane?
The InChIKey is PHVWIZNCYWRMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O5S.C5H12/c1-4-13(3)17-11-7-6-9-16-10-8-12-19(14,15)18-5-2;1-4-5(2)3/h13H,4-12H2,1-3H3;5H,4H2,1-3H3.
What are the key properties of ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane?
ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane has a molecular weight of 368.58 g/mol, XLogP of 4.41, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-butan-2-yloxybutoxy)propane-1-sulfonate;2-methylbutane is sourced from PubChem (CID 91575289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).