C64H62N12O2 — CID 91576029
4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 91576029) has the molecular formula C64H62N12O2 and a molecular weight of 1031.28 g/mol. Its IUPAC name is 4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 91576029 |
| Molecular Formula | C64H62N12O2 |
| Molecular Weight | 1031.28 g/mol |
| Exact Mass | 1030.51 |
| IUPAC Name | 4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1c(CN(Cc2ccccn2)Cc2ccccn2)cc(-c2cc(CN(Cc3ccccn3)Cc3ccccn3)c(O)c(CN(Cc3ccccn3)Cc3ccccn3)c2)cc1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C64H62N12O2/c77-63-51(37-73(41-55-17-1-9-25-65-55)42-56-18-2-10-26-66-56)33-49(34-52(63)38-74(43-57-19-3-11-27-67-57)44-58-20-4-12-28-68-58)50-35-53(39-75(45-59-21-5-13-29-69-59)46-60-22-6-14-30-70-60)64(78)54(36-50)40-76(47-61-23-7-15-31-71-61)48-62-24-8-16-32-72-62/h1-36,77-78H,37-48H2 |
| InChIKey | IQCGZUMGXYLUHT-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.28 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|