C30H19F3N2O3S — CID 91576481
1-(4-phenoxyphenyl)-2-sulfanylidene-5-[[2-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-diazinane-4,6-dione (PubChem CID 91576481) has the molecular formula C30H19F3N2O3S and a molecular weight of 544.55 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-2-sulfanylidene-5-[[2-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-phenoxyphenyl)-2-sulfanylidene-5-[[2-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91576481 |
| Molecular Formula | C30H19F3N2O3S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 1-(4-phenoxyphenyl)-2-sulfanylidene-5-[[2-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)C1=Cc1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H19F3N2O3S/c31-30(32,33)21-12-10-19(11-13-21)25-9-5-4-6-20(25)18-26-27(36)34-29(39)35(28(26)37)22-14-16-24(17-15-22)38-23-7-2-1-3-8-23/h1-18H,(H,34,36,39) |
| InChIKey | UFIABFCOYISXDP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|