C12H18N2O2S — CID 91576768
3-(5-iminohex-2-enylsulfonyl)cyclohexa-2,4-dien-1-amine (PubChem CID 91576768) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-(5-iminohex-2-enylsulfonyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 3-(5-iminohex-2-enylsulfonyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 91576768 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-(5-iminohex-2-enylsulfonyl)cyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C(\C)CC=CCS(=O)(=O)C1=CC(N)CC=C1 |
| InChI | InChI=1S/C12H18N2O2S/c1-10(13)5-2-3-8-17(15,16)12-7-4-6-11(14)9-12/h2-4,7,9,11,13H,5-6,8,14H2,1H3/b3-2?,13-10+ |
| InChIKey | DVCAKJDCBCVKDH-ATNXQONGSA-N |
| XLogP | 1.56 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|