C12H18N2O2S — CID 22094725
3-[(2E,4Z)-5-aminohexa-2,4-dienyl]sulfonylcyclohexa-2,4-dien-1-amine (PubChem CID 22094725) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-[(2E,4Z)-5-aminohexa-2,4-dienyl]sulfonylcyclohexa-2,4-dien-1-amine.
| Compound Name | 3-[(2E,4Z)-5-aminohexa-2,4-dienyl]sulfonylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 22094725 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[(2E,4Z)-5-aminohexa-2,4-dienyl]sulfonylcyclohexa-2,4-dien-1-amine |
| SMILES | C/C(N)=C/C=C/CS(=O)(=O)C1=CC(N)CC=C1 |
| InChI | InChI=1S/C12H18N2O2S/c1-10(13)5-2-3-8-17(15,16)12-7-4-6-11(14)9-12/h2-5,7,9,11H,6,8,13-14H2,1H3/b3-2+,10-5- |
| InChIKey | ZLYHWVVHRNQCTL-GQICYRDHSA-N |
| XLogP | 0.99 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|