C11H20N2O2S — CID 152744515
1-pentan-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 152744515) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-pentan-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-pentan-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 152744515 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-pentan-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | CCCC(C)S(=O)(=O)C1(N)C=CC=CC1N |
| InChI | InChI=1S/C11H20N2O2S/c1-3-6-9(2)16(14,15)11(13)8-5-4-7-10(11)12/h4-5,7-10H,3,6,12-13H2,1-2H3 |
| InChIKey | VBUJYKYGONFDJQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |