C11H18N2O2S — CID 152748396
1-cyclopentylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 152748396) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-cyclopentylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-cyclopentylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 152748396 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-cyclopentylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C11H18N2O2S/c12-10-7-3-4-8-11(10,13)16(14,15)9-5-1-2-6-9/h3-4,7-10H,1-2,5-6,12-13H2 |
| InChIKey | HLVUKPJDXYMWMS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |