C9H14N2O2S — CID 152748426
1-cyclopropylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 152748426) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-cyclopropylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-cyclopropylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 152748426 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-cyclopropylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C9H14N2O2S/c10-8-3-1-2-6-9(8,11)14(12,13)7-4-5-7/h1-3,6-8H,4-5,10-11H2 |
| InChIKey | CRNOMQQXIKLXPV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |