C12H20N2O2S — CID 152748380
1-cyclohexylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 152748380) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-cyclohexylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-cyclohexylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 152748380 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-cyclohexylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2O2S/c13-11-8-4-5-9-12(11,14)17(15,16)10-6-2-1-3-7-10/h4-5,8-11H,1-3,6-7,13-14H2 |
| InChIKey | WJKOSLTXJKZNMC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |