C9H15NO2S — CID 151789723
1-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine (PubChem CID 151789723) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 151789723 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-propan-2-ylsulfonylcyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)S(=O)(=O)C1(N)C=CC=CC1 |
| InChI | InChI=1S/C9H15NO2S/c1-8(2)13(11,12)9(10)6-4-3-5-7-9/h3-6,8H,7,10H2,1-2H3 |
| InChIKey | RWJGDRXRPOKYIC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |