C9H13NO2S — CID 143475769
4-prop-2-enylsulfonylcyclohexa-1,3-dien-1-amine (PubChem CID 143475769) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 4-prop-2-enylsulfonylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-prop-2-enylsulfonylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143475769 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-prop-2-enylsulfonylcyclohexa-1,3-dien-1-amine |
| SMILES | C=CCS(=O)(=O)C1=CC=C(N)CC1 |
| InChI | InChI=1S/C9H13NO2S/c1-2-7-13(11,12)9-5-3-8(10)4-6-9/h2-3,5H,1,4,6-7,10H2 |
| InChIKey | SYDZOBHVRIGDEB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|