C13H25FN2O2 — CID 91578087
tert-butyl N-[(6-fluoro-1-methylazepan-4-yl)methyl]carbamate (PubChem CID 91578087) has the molecular formula C13H25FN2O2 and a molecular weight of 260.35 g/mol. Its IUPAC name is tert-butyl N-[(6-fluoro-1-methylazepan-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-fluoro-1-methylazepan-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 91578087 |
| Molecular Formula | C13H25FN2O2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | tert-butyl N-[(6-fluoro-1-methylazepan-4-yl)methyl]carbamate |
| SMILES | CN1CCC(CNC(=O)OC(C)(C)C)CC(F)C1 |
| InChI | InChI=1S/C13H25FN2O2/c1-13(2,3)18-12(17)15-8-10-5-6-16(4)9-11(14)7-10/h10-11H,5-9H2,1-4H3,(H,15,17) |
| InChIKey | CKQNWGWTJFRAJH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |