C11H13F3N4O2 — CID 91580910
[piperidin-4-yl(pyrimidin-4-yl)amino] 2,2,2-trifluoroacetate (PubChem CID 91580910) has the molecular formula C11H13F3N4O2 and a molecular weight of 290.24 g/mol. Its IUPAC name is [piperidin-4-yl(pyrimidin-4-yl)amino] 2,2,2-trifluoroacetate.
| Compound Name | [piperidin-4-yl(pyrimidin-4-yl)amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91580910 |
| Molecular Formula | C11H13F3N4O2 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [piperidin-4-yl(pyrimidin-4-yl)amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(ON(c1ccncn1)C1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O2/c12-11(13,14)10(19)20-18(8-1-4-15-5-2-8)9-3-6-16-7-17-9/h3,6-8,15H,1-2,4-5H2 |
| InChIKey | BBAHNTBIIGLPLT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|