C54H69F15N4 — CID 91581556
4-heptyl-2-(4-heptyl-2-pyridinyl)pyridine;2-[4-(5,5,7,7,9,9-hexafluorodecyl)-2-pyridinyl]-4-(4,4,6,6,8,8,10,10,10-nonafluorodecyl)pyridine (PubChem CID 91581556) has the molecular formula C54H69F15N4 and a molecular weight of 1059.14 g/mol. Its IUPAC name is 4-heptyl-2-(4-heptyl-2-pyridinyl)pyridine;2-[4-(5,5,7,7,9,9-hexafluorodecyl)-2-pyridinyl]-4-(4,4,6,6,8,8,10,10,10-nonafluorodecyl)pyridine.
| Compound Name | 4-heptyl-2-(4-heptyl-2-pyridinyl)pyridine;2-[4-(5,5,7,7,9,9-hexafluorodecyl)-2-pyridinyl]-4-(4,4,6,6,8,8,10,10,10-nonafluorodecyl)pyridine |
|---|---|
| PubChem CID | 91581556 |
| Molecular Formula | C54H69F15N4 |
| Molecular Weight | 1059.14 g/mol |
| Exact Mass | 1058.53 |
| IUPAC Name | 4-heptyl-2-(4-heptyl-2-pyridinyl)pyridine;2-[4-(5,5,7,7,9,9-hexafluorodecyl)-2-pyridinyl]-4-(4,4,6,6,8,8,10,10,10-nonafluorodecyl)pyridine |
| SMILES | CC(F)(F)CC(F)(F)CC(F)(F)CCCCc1ccnc(-c2cc(CCCC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)F)ccn2)c1.CCCCCCCc1ccnc(-c2cc(CCCCCCC)ccn2)c1 |
| InChI | InChI=1S/C30H33F15N2.C24H36N2/c1-24(31,32)15-27(37,38)16-25(33,34)9-3-2-5-20-7-11-46-22(13-20)23-14-21(8-12-47-23)6-4-10-26(35,36)17-28(39,40)18-29(41,42)19-30(43,44)45;1-3-5-7-9-11-13-21-15-17-25-23(19-21)24-20-22(16-18-26-24)14-12-10-8-6-4-2/h7-8,11-14H,2-6,9-10,15-19H2,1H3;15-20H,3-14H2,1-2H3 |
| InChIKey | XNJDSTHZSWAGOM-UHFFFAOYSA-N |
| XLogP | 18.69 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.14 |
| LogP ≤ 5 | 18.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|