C19H21Cl2N3O2 — CID 91582137
3-[5-chloro-6-[[(2R)-1-[(4-chlorophenyl)methyl-methylamino]propan-2-yl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 91582137) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 3-[5-chloro-6-[[(2R)-1-[(4-chlorophenyl)methyl-methylamino]propan-2-yl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-6-[[(2R)-1-[(4-chlorophenyl)methyl-methylamino]propan-2-yl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91582137 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-[5-chloro-6-[[(2R)-1-[(4-chlorophenyl)methyl-methylamino]propan-2-yl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | C[C@H](CN(C)Cc1ccc(Cl)cc1)Nc1ncc(C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-13(11-24(2)12-14-3-6-16(20)7-4-14)23-19-17(21)9-15(10-22-19)5-8-18(25)26/h3-10,13H,11-12H2,1-2H3,(H,22,23)(H,25,26)/t13-/m1/s1 |
| InChIKey | DJSUFUSCXHQNQM-CYBMUJFWSA-N |
| XLogP | 4.42 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|