C18H33N2O6S+ — CID 91584526
tert-butyl 4-(1-acetyl-4-methylsulfonyloxypiperidin-1-ium-1-yl)piperidine-1-carboxylate (PubChem CID 91584526) has the molecular formula C18H33N2O6S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl 4-(1-acetyl-4-methylsulfonyloxypiperidin-1-ium-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-acetyl-4-methylsulfonyloxypiperidin-1-ium-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91584526 |
| Molecular Formula | C18H33N2O6S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl 4-(1-acetyl-4-methylsulfonyloxypiperidin-1-ium-1-yl)piperidine-1-carboxylate |
| SMILES | CC(=O)[N+]1(C2CCN(C(=O)OC(C)(C)C)CC2)CCC(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H33N2O6S/c1-14(21)20(12-8-16(9-13-20)26-27(5,23)24)15-6-10-19(11-7-15)17(22)25-18(2,3)4/h15-16H,6-13H2,1-5H3/q+1 |
| InChIKey | FCHJLIBKPNLYSR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|