C21H37NO3 — CID 91586086
tert-butyl 3-[1-(cyclopropylmethyl)-4-methoxy-4-methylcyclohexyl]pyrrolidine-1-carboxylate (PubChem CID 91586086) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is tert-butyl 3-[1-(cyclopropylmethyl)-4-methoxy-4-methylcyclohexyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(cyclopropylmethyl)-4-methoxy-4-methylcyclohexyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91586086 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | tert-butyl 3-[1-(cyclopropylmethyl)-4-methoxy-4-methylcyclohexyl]pyrrolidine-1-carboxylate |
| SMILES | COC1(C)CCC(CC2CC2)(C2CCN(C(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C21H37NO3/c1-19(2,3)25-18(23)22-13-8-17(15-22)21(14-16-6-7-16)11-9-20(4,24-5)10-12-21/h16-17H,6-15H2,1-5H3 |
| InChIKey | IPBQYMDKGSBFDZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |