C36H61N3O8Si2 — CID 91587170
tert-butyl (2S,3S)-2-amino-3-[(1R,4R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]cyclopentyl]-3-hydroxypropanoate (PubChem CID 91587170) has the molecular formula C36H61N3O8Si2 and a molecular weight of 720.07 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-amino-3-[(1R,4R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]cyclopentyl]-3-hydroxypropanoate.
| Compound Name | tert-butyl (2S,3S)-2-amino-3-[(1R,4R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]cyclopentyl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 91587170 |
| Molecular Formula | C36H61N3O8Si2 |
| Molecular Weight | 720.07 g/mol |
| Exact Mass | 719.40 |
| IUPAC Name | tert-butyl (2S,3S)-2-amino-3-[(1R,4R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]cyclopentyl]-3-hydroxypropanoate |
| SMILES | COc1ccc(Cn2c(=O)ccn([C@@H]3C[C@H]([C@H](O)[C@H](N)C(=O)OC(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)c2=O)cc1 |
| InChI | InChI=1S/C36H61N3O8Si2/c1-34(2,3)45-32(42)28(37)29(41)25-21-26(31(47-49(13,14)36(7,8)9)30(25)46-48(11,12)35(4,5)6)38-20-19-27(40)39(33(38)43)22-23-15-17-24(44-10)18-16-23/h15-20,25-26,28-31,41H,21-22,37H2,1-14H3/t25-,26-,28+,29+,30?,31?/m1/s1 |
| InChIKey | QAGOMEGNBULPLS-PNBSRYPDSA-N |
| XLogP | 5.44 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.07 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|