C35H59N3O8Si2 — CID 46221016
tert-butyl (2S)-2-amino-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]propanoate (PubChem CID 46221016) has the molecular formula C35H59N3O8Si2 and a molecular weight of 706.04 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]propanoate.
| Compound Name | tert-butyl (2S)-2-amino-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 46221016 |
| Molecular Formula | C35H59N3O8Si2 |
| Molecular Weight | 706.04 g/mol |
| Exact Mass | 705.38 |
| IUPAC Name | tert-butyl (2S)-2-amino-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[(4-methoxyphenyl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]propanoate |
| SMILES | COc1ccc(Cn2c(=O)ccn([C@@H]3O[C@H](C[C@H](N)C(=O)OC(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)c2=O)cc1 |
| InChI | InChI=1S/C35H59N3O8Si2/c1-33(2,3)44-31(40)25(36)21-26-28(45-47(11,12)34(4,5)6)29(46-48(13,14)35(7,8)9)30(43-26)37-20-19-27(39)38(32(37)41)22-23-15-17-24(42-10)18-16-23/h15-20,25-26,28-30H,21-22,36H2,1-14H3/t25-,26+,28+,29+,30+/m0/s1 |
| InChIKey | OZKOZWPFSBFXDN-OTHMCYNBSA-N |
| XLogP | 5.80 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.04 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|