C22H19N7O5 — CID 91588032
6-[3-(2-nitrobenzoyl)-2-oxo-1,3-diazinan-1-yl]-N-(pyridin-2-ylmethyl)pyridazine-3-carboxamide (PubChem CID 91588032) has the molecular formula C22H19N7O5 and a molecular weight of 461.44 g/mol. Its IUPAC name is 6-[3-(2-nitrobenzoyl)-2-oxo-1,3-diazinan-1-yl]-N-(pyridin-2-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-[3-(2-nitrobenzoyl)-2-oxo-1,3-diazinan-1-yl]-N-(pyridin-2-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 91588032 |
| Molecular Formula | C22H19N7O5 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 6-[3-(2-nitrobenzoyl)-2-oxo-1,3-diazinan-1-yl]-N-(pyridin-2-ylmethyl)pyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1ccc(N2CCCN(C(=O)c3ccccc3[N+](=O)[O-])C2=O)nn1 |
| InChI | InChI=1S/C22H19N7O5/c30-20(24-14-15-6-3-4-11-23-15)17-9-10-19(26-25-17)27-12-5-13-28(22(27)32)21(31)16-7-1-2-8-18(16)29(33)34/h1-4,6-11H,5,12-14H2,(H,24,30) |
| InChIKey | LWFJFPCHMAEFOZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|