C25H34N6O4 — CID 91604841
N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-1,3-diazinan-1-yl]pyridazine-3-carboxamide (PubChem CID 91604841) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-1,3-diazinan-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-1,3-diazinan-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 91604841 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-1,3-diazinan-1-yl]pyridazine-3-carboxamide |
| SMILES | CC(C)CC(C)CC(C)NC(=O)c1ccc(N2CCCN(C(=O)c3ccccc3[N+](=O)[O-])C2)nn1 |
| InChI | InChI=1S/C25H34N6O4/c1-17(2)14-18(3)15-19(4)26-24(32)21-10-11-23(28-27-21)29-12-7-13-30(16-29)25(33)20-8-5-6-9-22(20)31(34)35/h5-6,8-11,17-19H,7,12-16H2,1-4H3,(H,26,32) |
| InChIKey | MUSKUNJAHYRQTJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|