C26H33N5O4 — CID 69397603
N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-2,4-dihydropyrimidin-1-yl]pyridine-3-carboxamide (PubChem CID 69397603) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-2,4-dihydropyrimidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-2,4-dihydropyrimidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69397603 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-(4,6-dimethylheptan-2-yl)-6-[3-(2-nitrobenzoyl)-2,4-dihydropyrimidin-1-yl]pyridine-3-carboxamide |
| SMILES | CC(C)CC(C)CC(C)NC(=O)c1ccc(N2C=CCN(C(=O)c3ccccc3[N+](=O)[O-])C2)nc1 |
| InChI | InChI=1S/C26H33N5O4/c1-18(2)14-19(3)15-20(4)28-25(32)21-10-11-24(27-16-21)29-12-7-13-30(17-29)26(33)22-8-5-6-9-23(22)31(34)35/h5-12,16,18-20H,13-15,17H2,1-4H3,(H,28,32) |
| InChIKey | BPSXFTQXKZXIEY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|