C21H26N6O5 — CID 67417886
[6-[4-(2-nitrobenzoyl)piperazin-1-yl]pyridazin-3-yl] N-(3-methylbutyl)carbamate (PubChem CID 67417886) has the molecular formula C21H26N6O5 and a molecular weight of 442.48 g/mol. Its IUPAC name is [6-[4-(2-nitrobenzoyl)piperazin-1-yl]pyridazin-3-yl] N-(3-methylbutyl)carbamate.
| Compound Name | [6-[4-(2-nitrobenzoyl)piperazin-1-yl]pyridazin-3-yl] N-(3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 67417886 |
| Molecular Formula | C21H26N6O5 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [6-[4-(2-nitrobenzoyl)piperazin-1-yl]pyridazin-3-yl] N-(3-methylbutyl)carbamate |
| SMILES | CC(C)CCNC(=O)Oc1ccc(N2CCN(C(=O)c3ccccc3[N+](=O)[O-])CC2)nn1 |
| InChI | InChI=1S/C21H26N6O5/c1-15(2)9-10-22-21(29)32-19-8-7-18(23-24-19)25-11-13-26(14-12-25)20(28)16-5-3-4-6-17(16)27(30)31/h3-8,15H,9-14H2,1-2H3,(H,22,29) |
| InChIKey | ZANREWXFZBRUCR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|