About 5-iminopent-1-en-3-amine
5-iminopent-1-en-3-amine (PubChem CID 91588236) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 5-iminopent-1-en-3-amine.
Molecular Properties
| Compound Name | 5-iminopent-1-en-3-amine |
| PubChem CID | 91588236 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 5-iminopent-1-en-3-amine |
| SMILES | [H]/N=C/CC(N)C=C |
| InChI | InChI=1S/C5H10N2/c1-2-5(7)3-4-6/h2,4-6H,1,3,7H2/b6-4+ |
| InChIKey | WTXSEODKDOSMME-GQCTYLIASA-N |
| XLogP | 0.54 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-iminopent-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminopent-1-en-3-amine?
The IUPAC name of 5-iminopent-1-en-3-amine (CID 91588236) is 5-iminopent-1-en-3-amine.
What is the SMILES notation for 5-iminopent-1-en-3-amine?
The canonical SMILES for 5-iminopent-1-en-3-amine is [H]/N=C/CC(N)C=C.
What is the InChIKey of 5-iminopent-1-en-3-amine?
The InChIKey is WTXSEODKDOSMME-GQCTYLIASA-N. The full InChI is InChI=1S/C5H10N2/c1-2-5(7)3-4-6/h2,4-6H,1,3,7H2/b6-4+.
What are the key properties of 5-iminopent-1-en-3-amine?
5-iminopent-1-en-3-amine has a molecular weight of 98.15 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminopent-1-en-3-amine is sourced from PubChem (CID 91588236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).