C18H23N3O2S — CID 91589389
[5-[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]thiophen-2-yl]urea (PubChem CID 91589389) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is [5-[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]thiophen-2-yl]urea.
| Compound Name | [5-[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]thiophen-2-yl]urea |
|---|---|
| PubChem CID | 91589389 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [5-[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]thiophen-2-yl]urea |
| SMILES | CC1CN(Cc2ccc(-c3ccc(NC(N)=O)s3)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H23N3O2S/c1-12-9-21(10-13(2)23-12)11-14-3-5-15(6-4-14)16-7-8-17(24-16)20-18(19)22/h3-8,12-13H,9-11H2,1-2H3,(H3,19,20,22) |
| InChIKey | ZOTULXONXBOUFR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |