C12H26O2Si — CID 91591248
4-[butyl(dimethyl)silyl]oxy-2,2-dimethylbutanal (PubChem CID 91591248) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is 4-[butyl(dimethyl)silyl]oxy-2,2-dimethylbutanal.
| Compound Name | 4-[butyl(dimethyl)silyl]oxy-2,2-dimethylbutanal |
|---|---|
| PubChem CID | 91591248 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4-[butyl(dimethyl)silyl]oxy-2,2-dimethylbutanal |
| SMILES | CCCC[Si](C)(C)OCCC(C)(C)C=O |
| InChI | InChI=1S/C12H26O2Si/c1-6-7-10-15(4,5)14-9-8-12(2,3)11-13/h11H,6-10H2,1-5H3 |
| InChIKey | QKLMJLZSAWZWHT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|