C14H24N2O2 — CID 91591369
1-[5-(2,2-diethylbutoxy)pyrazin-2-yl]ethanol (PubChem CID 91591369) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-[5-(2,2-diethylbutoxy)pyrazin-2-yl]ethanol.
| Compound Name | 1-[5-(2,2-diethylbutoxy)pyrazin-2-yl]ethanol |
|---|---|
| PubChem CID | 91591369 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-[5-(2,2-diethylbutoxy)pyrazin-2-yl]ethanol |
| SMILES | CCC(CC)(CC)COc1cnc(C(C)O)cn1 |
| InChI | InChI=1S/C14H24N2O2/c1-5-14(6-2,7-3)10-18-13-9-15-12(8-16-13)11(4)17/h8-9,11,17H,5-7,10H2,1-4H3 |
| InChIKey | HLJUQOOVLAPUOI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |