C14H15F12NO — CID 91595109
N-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-2-ethylbut-2-enamide (PubChem CID 91595109) has the molecular formula C14H15F12NO and a molecular weight of 441.26 g/mol. Its IUPAC name is N-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-2-ethylbut-2-enamide.
| Compound Name | N-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-2-ethylbut-2-enamide |
|---|---|
| PubChem CID | 91595109 |
| Molecular Formula | C14H15F12NO |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctyl)-2-ethylbut-2-enamide |
| SMILES | CC=C(CC)C(=O)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H15F12NO/c1-3-7(4-2)8(28)27-6-5-10(17,18)12(21,22)14(25,26)13(23,24)11(19,20)9(15)16/h3,9H,4-6H2,1-2H3,(H,27,28) |
| InChIKey | CJWMAJUDYAGFCL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|