C12H17NO5 — CID 91595716
ethyl 4-formyl-3,5-dioxo-5-pyrrolidin-1-ylpentanoate (PubChem CID 91595716) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is ethyl 4-formyl-3,5-dioxo-5-pyrrolidin-1-ylpentanoate.
| Compound Name | ethyl 4-formyl-3,5-dioxo-5-pyrrolidin-1-ylpentanoate |
|---|---|
| PubChem CID | 91595716 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | ethyl 4-formyl-3,5-dioxo-5-pyrrolidin-1-ylpentanoate |
| SMILES | CCOC(=O)CC(=O)C(C=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H17NO5/c1-2-18-11(16)7-10(15)9(8-14)12(17)13-5-3-4-6-13/h8-9H,2-7H2,1H3 |
| InChIKey | RLQPWOKKBDDXFW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|