C23H27F4N3O3 — CID 91596634
2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 91596634) has the molecular formula C23H27F4N3O3 and a molecular weight of 469.48 g/mol. Its IUPAC name is 2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91596634 |
| Molecular Formula | C23H27F4N3O3 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCCN1CCN(c3ccc(F)cc3OCC(F)(F)F)CC1)CC=CC2 |
| InChI | InChI=1S/C23H27F4N3O3/c24-16-6-7-19(20(14-16)33-15-23(25,26)27)29-12-10-28(11-13-29)8-3-9-30-21(31)17-4-1-2-5-18(17)22(30)32/h1-2,6-7,14,31-32H,3-5,8-13,15H2 |
| InChIKey | FXSQBPPMXLIEJX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|