C10H12N2O — CID 91598643
1,4,5,6,7,8-hexahydrocyclopenta[f]indazol-5-ol (PubChem CID 91598643) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexahydrocyclopenta[f]indazol-5-ol.
| Compound Name | 1,4,5,6,7,8-hexahydrocyclopenta[f]indazol-5-ol |
|---|---|
| PubChem CID | 91598643 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1,4,5,6,7,8-hexahydrocyclopenta[f]indazol-5-ol |
| SMILES | OC1CCC2=C1Cc1cn[nH]c1C2 |
| InChI | InChI=1S/C10H12N2O/c13-10-2-1-6-4-9-7(3-8(6)10)5-11-12-9/h5,10,13H,1-4H2,(H,11,12) |
| InChIKey | CNYSFRNAVGNNIH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|