C11H9F11N2O — CID 10475700
3-[5-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol (PubChem CID 10475700) has the molecular formula C11H9F11N2O and a molecular weight of 394.18 g/mol. Its IUPAC name is 3-[5-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol.
| Compound Name | 3-[5-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 10475700 |
| Molecular Formula | C11H9F11N2O |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 3-[5-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol |
| SMILES | OCCCc1cn[nH]c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F11N2O/c12-7(13,6-5(2-1-3-25)4-23-24-6)8(14,15)9(16,17)10(18,19)11(20,21)22/h4,25H,1-3H2,(H,23,24) |
| InChIKey | RHDXQURBHMLMFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|