C9H9ClF6N2O — CID 10267428
3-[5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1H-pyrazol-4-yl]propan-1-ol (PubChem CID 10267428) has the molecular formula C9H9ClF6N2O and a molecular weight of 310.63 g/mol. Its IUPAC name is 3-[5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1H-pyrazol-4-yl]propan-1-ol.
| Compound Name | 3-[5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1H-pyrazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 10267428 |
| Molecular Formula | C9H9ClF6N2O |
| Molecular Weight | 310.63 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-[5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1H-pyrazol-4-yl]propan-1-ol |
| SMILES | OCCCc1cn[nH]c1C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C9H9ClF6N2O/c10-9(15,16)8(13,14)7(11,12)6-5(2-1-3-19)4-17-18-6/h4,19H,1-3H2,(H,17,18) |
| InChIKey | CGZJTJSKQMPHMK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|