C13H9ClF14N2O — CID 10052062
3-[5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazol-4-yl]propan-1-ol (PubChem CID 10052062) has the molecular formula C13H9ClF14N2O and a molecular weight of 510.65 g/mol. Its IUPAC name is 3-[5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazol-4-yl]propan-1-ol.
| Compound Name | 3-[5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 10052062 |
| Molecular Formula | C13H9ClF14N2O |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 3-[5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazol-4-yl]propan-1-ol |
| SMILES | OCCCc1cn[nH]c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C13H9ClF14N2O/c14-13(27,28)12(25,26)11(23,24)10(21,22)9(19,20)8(17,18)7(15,16)6-5(2-1-3-31)4-29-30-6/h4,31H,1-3H2,(H,29,30) |
| InChIKey | SOOZIAMDPZCOEF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|