C11H9ClF10N2O — CID 10047203
3-[5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol (PubChem CID 10047203) has the molecular formula C11H9ClF10N2O and a molecular weight of 410.64 g/mol. Its IUPAC name is 3-[5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol.
| Compound Name | 3-[5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 10047203 |
| Molecular Formula | C11H9ClF10N2O |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 3-[5-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1H-pyrazol-4-yl]propan-1-ol |
| SMILES | OCCCc1cn[nH]c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C11H9ClF10N2O/c12-11(21,22)10(19,20)9(17,18)8(15,16)7(13,14)6-5(2-1-3-25)4-23-24-6/h4,25H,1-3H2,(H,23,24) |
| InChIKey | SLVNBFYXKOYKHN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|