C17H18N4O2S — CID 91598920
6-(4-piperidin-1-ylsulfonylphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 91598920) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-(4-piperidin-1-ylsulfonylphenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-(4-piperidin-1-ylsulfonylphenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 91598920 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-(4-piperidin-1-ylsulfonylphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | O=S(=O)(c1ccc(-c2cnc3nc[nH]c3c2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C17H18N4O2S/c22-24(23,21-8-2-1-3-9-21)15-6-4-13(5-7-15)14-10-16-17(18-11-14)20-12-19-16/h4-7,10-12H,1-3,8-9H2,(H,18,19,20) |
| InChIKey | AJQUZQBIPXFUNF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |