C11H16O2 — CID 91599212
(1R)-1-(1,2,3-13C3)prop-1-ynylspiro[2.5]octane-2,2-diol (PubChem CID 91599212) has the molecular formula C11H16O2 and a molecular weight of 185.21 g/mol. Its IUPAC name is (1R)-1-(1,2,3-13C3)prop-1-ynylspiro[2.5]octane-2,2-diol.
| Compound Name | (1R)-1-(1,2,3-13C3)prop-1-ynylspiro[2.5]octane-2,2-diol |
|---|---|
| PubChem CID | 91599212 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | (1R)-1-(1,2,3-13C3)prop-1-ynylspiro[2.5]octane-2,2-diol |
| SMILES | [13CH3][13C]#[13C][13C@@H]1C2(CCCCC2)[13C]1(O)O |
| InChI | InChI=1S/C11H16O2/c1-2-6-9-10(11(9,12)13)7-4-3-5-8-10/h9,12-13H,3-5,7-8H2,1H3/t9-/m1/s1/i1+1,2+1,6+1,9+1,11+1 |
| InChIKey | YPHBIQAHGUHEBH-NWMBVHOQSA-N |
| XLogP | 1.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|