C18H27ClN2O2S — CID 91602582
3-(chloromethyl)-N-[3-(4-methylpiperidin-1-yl)cyclopentyl]benzenesulfonamide (PubChem CID 91602582) has the molecular formula C18H27ClN2O2S and a molecular weight of 370.95 g/mol. Its IUPAC name is 3-(chloromethyl)-N-[3-(4-methylpiperidin-1-yl)cyclopentyl]benzenesulfonamide.
| Compound Name | 3-(chloromethyl)-N-[3-(4-methylpiperidin-1-yl)cyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91602582 |
| Molecular Formula | C18H27ClN2O2S |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-(chloromethyl)-N-[3-(4-methylpiperidin-1-yl)cyclopentyl]benzenesulfonamide |
| SMILES | CC1CCN(C2CCC(NS(=O)(=O)c3cccc(CCl)c3)C2)CC1 |
| InChI | InChI=1S/C18H27ClN2O2S/c1-14-7-9-21(10-8-14)17-6-5-16(12-17)20-24(22,23)18-4-2-3-15(11-18)13-19/h2-4,11,14,16-17,20H,5-10,12-13H2,1H3 |
| InChIKey | BOQPWWJWKZPFLM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|