C24H37NO2S — CID 91604929
(3R,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6-carbaldehyde (PubChem CID 91604929) has the molecular formula C24H37NO2S and a molecular weight of 403.63 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6-carbaldehyde.
| Compound Name | (3R,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6-carbaldehyde |
|---|---|
| PubChem CID | 91604929 |
| Molecular Formula | C24H37NO2S |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-[(3R)-pyrrolidin-3-yl]sulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-6-carbaldehyde |
| SMILES | C[C@]12CC[C@@H](S[C@@H]3CCNC3)CC1C(C=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H37NO2S/c1-23-8-5-16(28-17-7-10-25-13-17)12-21(23)15(14-26)11-18-19-3-4-22(27)24(19,2)9-6-20(18)23/h14-21,25H,3-13H2,1-2H3/t15?,16-,17-,18+,19+,20+,21?,23-,24+/m1/s1 |
| InChIKey | HOVIJSHDYXNEIP-WRPHXJHNSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|