C25H33FO5 — CID 91605909
(4R,9'R,10'S,11'S,13'S,16'R)-9'-fluoro-11'-hydroxy-2,2,10',13',16'-pentamethylspiro[1,3-dioxane-4,17'-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5-dione (PubChem CID 91605909) has the molecular formula C25H33FO5 and a molecular weight of 432.53 g/mol. Its IUPAC name is (4R,9'R,10'S,11'S,13'S,16'R)-9'-fluoro-11'-hydroxy-2,2,10',13',16'-pentamethylspiro[1,3-dioxane-4,17'-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5-dione.
| Compound Name | (4R,9'R,10'S,11'S,13'S,16'R)-9'-fluoro-11'-hydroxy-2,2,10',13',16'-pentamethylspiro[1,3-dioxane-4,17'-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5-dione |
|---|---|
| PubChem CID | 91605909 |
| Molecular Formula | C25H33FO5 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (4R,9'R,10'S,11'S,13'S,16'R)-9'-fluoro-11'-hydroxy-2,2,10',13',16'-pentamethylspiro[1,3-dioxane-4,17'-4,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5-dione |
| SMILES | C[C@@H]1CC2C3CC=C4CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@]12OC(C)(C)OCC2=O |
| InChI | InChI=1S/C25H33FO5/c1-14-10-18-17-7-6-15-11-16(27)8-9-22(15,4)24(17,26)19(28)12-23(18,5)25(14)20(29)13-30-21(2,3)31-25/h6,8-9,14,17-19,28H,7,10-13H2,1-5H3/t14-,17?,18?,19+,22+,23+,24+,25+/m1/s1 |
| InChIKey | ZLHLHQCLOUMMBS-XHAMYZCFSA-N |
| XLogP | 3.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|