C26H28N4O2 — CID 91608611
(2S)-2-amino-1-[(2S)-4,5-bis(ethenyl)-2-(5-phenyl-1H-imidazol-2-yl)-2,3-dihydropyrrol-1-yl]nona-4,8-diene-1,7-dione (PubChem CID 91608611) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2S)-4,5-bis(ethenyl)-2-(5-phenyl-1H-imidazol-2-yl)-2,3-dihydropyrrol-1-yl]nona-4,8-diene-1,7-dione.
| Compound Name | (2S)-2-amino-1-[(2S)-4,5-bis(ethenyl)-2-(5-phenyl-1H-imidazol-2-yl)-2,3-dihydropyrrol-1-yl]nona-4,8-diene-1,7-dione |
|---|---|
| PubChem CID | 91608611 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2S)-2-amino-1-[(2S)-4,5-bis(ethenyl)-2-(5-phenyl-1H-imidazol-2-yl)-2,3-dihydropyrrol-1-yl]nona-4,8-diene-1,7-dione |
| SMILES | C=CC(=O)CC=CC[C@H](N)C(=O)N1C(C=C)=C(C=C)C[C@H]1c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H28N4O2/c1-4-18-16-24(25-28-17-22(29-25)19-12-8-7-9-13-19)30(23(18)6-3)26(32)21(27)15-11-10-14-20(31)5-2/h4-13,17,21,24H,1-3,14-16,27H2,(H,28,29)/t21-,24-/m0/s1 |
| InChIKey | JOAWTDXWCJLTPP-URXFXBBRSA-N |
| XLogP | 4.39 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|