About 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine
3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 91608823) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine.
Analyze 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine?
The IUPAC name of 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine (CID 91608823) is 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine.
What is the SMILES notation for 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine?
The canonical SMILES for 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine is C=c1ncc2c(c1=C)CCC2.
What is the InChIKey of 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine?
The InChIKey is AETRHUQPAHWGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-7-8(2)11-6-9-4-3-5-10(7)9/h6H,1-5H2.
What are the key properties of 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine?
3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine has a molecular weight of 145.20 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylidene-6,7-dihydro-5H-cyclopenta[c]pyridine is sourced from PubChem (CID 91608823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).