C22H16N2O — CID 91609781
6-ethylidene-4-methyl-3,11-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,7,9,13,15,17(21),18-nonaen-12-one (PubChem CID 91609781) has the molecular formula C22H16N2O and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-ethylidene-4-methyl-3,11-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,7,9,13,15,17(21),18-nonaen-12-one.
| Compound Name | 6-ethylidene-4-methyl-3,11-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,7,9,13,15,17(21),18-nonaen-12-one |
|---|---|
| PubChem CID | 91609781 |
| Molecular Formula | C22H16N2O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-ethylidene-4-methyl-3,11-diazapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,7,9,13,15,17(21),18-nonaen-12-one |
| SMILES | CC=c1cccc2c1c(C)nc1c3cccc4cccc(c(=O)n21)c43 |
| InChI | InChI=1S/C22H16N2O/c1-3-14-7-6-12-18-19(14)13(2)23-21-16-10-4-8-15-9-5-11-17(20(15)16)22(25)24(18)21/h3-12H,1-2H3 |
| InChIKey | IXGDOXHYNLQDIA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|